CAS 210532-24-4 appears in our catalog under these names: 2,3-Difluorobenzene-1-sulfonyl chloride, 95%, 2,3-Difluorobenzenesulfonyl chloride, 2,3-Difluorobenzenesulfonyl chloride, 98%, 2,3-Difluorobenzene-1-sulfonyl chloride, 98%. Offered by: Combi-blocks, Biosynth, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 2,5g, 25g, 250mg.
2,3-difluorobenzenesulfonyl chloride (CAS 210532-24-4) is a chemical compound with the molecular formula C6H3ClF2O2S and a molecular weight of 212.60 g/mol. IUPAC name: 2,3-difluorobenzenesulfonyl chloride. InChIKey: VHCVYGNNCGAWBP-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF2O2S |
|---|---|
| Molecular weight | 212.60 g/mol |
| IUPAC name | 2,3-difluorobenzenesulfonyl chloride |
| InChIKey | VHCVYGNNCGAWBP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S(=O)(=O)Cl)F)F |
Computed by PubChem (NCBI)