CAS 26120-86-5 appears in our catalog under these names: 2,5–Difluorobenzenesulfonyl chloride, 2,5-Difluorobenzenesulfonyl chloride, 97%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 10g.
2,5-difluorobenzenesulfonyl chloride (CAS 26120-86-5) is a chemical compound with the molecular formula C6H3ClF2O2S and a molecular weight of 212.60 g/mol. IUPAC name: 2,5-difluorobenzenesulfonyl chloride. InChIKey: CELLJWUVMKEJDY-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF2O2S |
|---|---|
| Molecular weight | 212.60 g/mol |
| IUPAC name | 2,5-difluorobenzenesulfonyl chloride |
| InChIKey | CELLJWUVMKEJDY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)