CAS 1936197-87-3 is the registry number for 2-(2-Chlorothiophen-3-yl)-2,2-difluoroacetic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(2-chlorothiophen-3-yl)-2,2-difluoroacetic acid (CAS 1936197-87-3) is a chemical compound with the molecular formula C6H3ClF2O2S and a molecular weight of 212.60 g/mol. IUPAC name: 2-(2-chlorothiophen-3-yl)-2,2-difluoroacetic acid. InChIKey: XKVQGSGDRXWWQX-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF2O2S |
|---|---|
| Molecular weight | 212.60 g/mol |
| IUPAC name | 2-(2-chlorothiophen-3-yl)-2,2-difluoroacetic acid |
| InChIKey | XKVQGSGDRXWWQX-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1C(C(=O)O)(F)F)Cl |
Computed by PubChem (NCBI)