cas: 172935-91-0 — see every product listed under this CAS number, including other names
2,6-Difluorobenzhydrazide, 97%, 97% (CAS 172935-91-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11442J-250mg |
| cas | 172935-91-0 |
| size | 250mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 957.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,6-difluorobenzohydrazide (CAS 172935-91-0) is a chemical compound with the molecular formula C7H6F2N2O and a molecular weight of 172.13 g/mol. IUPAC name: 2,6-difluorobenzohydrazide. InChIKey: GVZACAPOZBPAMJ-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2,6-difluorobenzohydrazide |
| InChIKey | GVZACAPOZBPAMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)NN)F |
Computed by PubChem (NCBI)