cas: 172935-91-0 — see every product listed under this CAS number, including other names
2,6-Difluorobenzhydrazide, 97% (CAS 172935-91-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F019258-1G |
| cas | 172935-91-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 810.15 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,6-difluorobenzohydrazide (CAS 172935-91-0) is a chemical compound with the molecular formula C7H6F2N2O and a molecular weight of 172.13 g/mol. IUPAC name: 2,6-difluorobenzohydrazide. InChIKey: GVZACAPOZBPAMJ-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2,6-difluorobenzohydrazide |
| InChIKey | GVZACAPOZBPAMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)NN)F |
Computed by PubChem (NCBI)