Products 385-00-2
CAS 385-00-2 appears in our catalog under these names: 2,6-Difluorobenzoic acid, 98%, 2,6-Difluorobenzoic Acid, 2,6–Difluorobenzoic acid, 2,6-Difluorobenzoic acid/ 97%, 2,6-Difluorobenzoic acid, 98+% . Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, Chemat. Available pack sizes: 5g, 500g, 100g, 1kg, 25g, 250g, 250mg, 0,5kg.
2,6-difluorobenzoic acid (CAS 385-00-2) is a chemical compound with the molecular formula C7H4F2O2 and a molecular weight of 158.10 g/mol. IUPAC name: 2,6-difluorobenzoic acid. InChIKey: ONOTYLMNTZNAQZ-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O2 |
|---|---|
| Molecular weight | 158.10 g/mol |
| IUPAC name | 2,6-difluorobenzoic acid |
| InChIKey | ONOTYLMNTZNAQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)O)F |
Computed by PubChem (NCBI)