Products 502496-26-6

CAS 502496-26-6 appears in our catalog under these names: 2,6-Difluorophenylhydrazine hydrochloride, 98%, (2,6-Difluorophenyl)hydrazine hydrochloride, 97%, 97%, 2,6-Difluorophenylhydrazine hydrochloride, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 1g, 100g, 5g, 250mg, 50g.

Structural formula: {0} (CAS {1})

(2,6-difluorophenyl)hydrazine;hydrochloride (CAS 502496-26-6) is a chemical compound with the molecular formula C6H7ClF2N2 and a molecular weight of 180.58 g/mol. IUPAC name: (2,6-difluorophenyl)hydrazine;hydrochloride. InChIKey: RSOSGLCEIHAGQV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClF2N2
Molecular weight180.58 g/mol
IUPAC name(2,6-difluorophenyl)hydrazine;hydrochloride
InChIKeyRSOSGLCEIHAGQV-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)F)NN)F.Cl

Computed by PubChem (NCBI)