Products 60481-38-1

CAS 60481-38-1 appears in our catalog under these names: (2,3–Difluorophenyl)hydrazine hydrochloride, (2,3-Difluorophenyl)hydrazine hydrochloride 97%, (2,3-Difluorophenyl)hydrazine hydrochloride, 98%, 98%, (2,3-Difluorophenyl)hydrazine hydrochloride, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 25g.

Structural formula: {0} (CAS {1})

(2,3-difluorophenyl)hydrazine;hydrochloride (CAS 60481-38-1) is a chemical compound with the molecular formula C6H7ClF2N2 and a molecular weight of 180.58 g/mol. IUPAC name: (2,3-difluorophenyl)hydrazine;hydrochloride. InChIKey: SDFAWGYUVRQFQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClF2N2
Molecular weight180.58 g/mol
IUPAC name(2,3-difluorophenyl)hydrazine;hydrochloride
InChIKeySDFAWGYUVRQFQZ-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)F)F)NN.Cl

Computed by PubChem (NCBI)