Products 875664-54-3

CAS 875664-54-3 appears in our catalog under these names: 3,4–Difluorophenylhydrazine, HCl, (3,4-Difluorophenyl)hydrazine hydrochloride, (3,4-Difluorophenyl)hydrazine hydrochloride 98%, (3,4-Difluorophenyl)hydrazine hydrochloride, 98%, 98%, 3,4-Difluorophenylhydrazine hydrochloride, 96%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

(3,4-difluorophenyl)hydrazine;hydrochloride (CAS 875664-54-3) is a chemical compound with the molecular formula C6H7ClF2N2 and a molecular weight of 180.58 g/mol. IUPAC name: (3,4-difluorophenyl)hydrazine;hydrochloride. InChIKey: QTEJTSFVIILHJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClF2N2
Molecular weight180.58 g/mol
IUPAC name(3,4-difluorophenyl)hydrazine;hydrochloride
InChIKeyQTEJTSFVIILHJJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1NN)F)F.Cl

Computed by PubChem (NCBI)