Products 1646152-50-2

CAS 1646152-50-2 is the registry number for 6-(Difluoromethyl)pyridin-3-amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

6-(difluoromethyl)pyridin-3-amine;hydrochloride (CAS 1646152-50-2) is a chemical compound with the molecular formula C6H7ClF2N2 and a molecular weight of 180.58 g/mol. IUPAC name: 6-(difluoromethyl)pyridin-3-amine;hydrochloride. InChIKey: HNAHLGAGIBHCRG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClF2N2
Molecular weight180.58 g/mol
IUPAC name6-(difluoromethyl)pyridin-3-amine;hydrochloride
InChIKeyHNAHLGAGIBHCRG-UHFFFAOYSA-N
SMILESC1=CC(=NC=C1N)C(F)F.Cl

Computed by PubChem (NCBI)