cas: 363166-79-4 — see every product listed under this CAS number, including other names
2,6-Diisopropylphenylboronic Acid 96% (CAS 363166-79-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A568452-100mg |
| cas | 363166-79-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 670.75 Pln | |
| Ambeed | 25g | 2662.12 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A568452 |
[2,6-di(propan-2-yl)phenyl]boronic acid (CAS 363166-79-4) is a chemical compound with the molecular formula C12H19BO2 and a molecular weight of 206.09 g/mol. IUPAC name: [2,6-di(propan-2-yl)phenyl]boronic acid. InChIKey: UPXGMXMTUMCLGD-UHFFFAOYSA-N.
| Molecular formula | C12H19BO2 |
|---|---|
| Molecular weight | 206.09 g/mol |
| IUPAC name | [2,6-di(propan-2-yl)phenyl]boronic acid |
| InChIKey | UPXGMXMTUMCLGD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1C(C)C)C(C)C)(O)O |
Computed by PubChem (NCBI)