Products 363166-79-4
CAS 363166-79-4 appears in our catalog under these names: 2,6-Diisopropylphenylboronic acid, 96%, 2,6-Diisopropylphenylboronic acid, 95-<97%, 2,6-Diisopropylphenylboronic acid, ≥97-<99%, 2,6–Diisopropylphenylboronic acid, 2,6-Diisopropylphenylboronic Acid 96%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 200g, 300g.
[2,6-di(propan-2-yl)phenyl]boronic acid (CAS 363166-79-4) is a chemical compound with the molecular formula C12H19BO2 and a molecular weight of 206.09 g/mol. IUPAC name: [2,6-di(propan-2-yl)phenyl]boronic acid. InChIKey: UPXGMXMTUMCLGD-UHFFFAOYSA-N.
| Molecular formula | C12H19BO2 |
|---|---|
| Molecular weight | 206.09 g/mol |
| IUPAC name | [2,6-di(propan-2-yl)phenyl]boronic acid |
| InChIKey | UPXGMXMTUMCLGD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1C(C)C)C(C)C)(O)O |
Computed by PubChem (NCBI)