CAS 105365-50-2 appears in our catalog under these names: 4-Hexylphenylboronic acid, 98%, 4–Hexylphenylboronic Acid, 4-Hexylphenylboronic Acid (contains varying amounts of Anhydride), 4-Hexylphenylboronic Acid, 97%, 97%, (4-Hexylphenyl)boronic acid, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(4-hexylphenyl)boronic acid (CAS 105365-50-2) is a chemical compound with the molecular formula C12H19BO2 and a molecular weight of 206.09 g/mol. IUPAC name: (4-hexylphenyl)boronic acid. InChIKey: CFYBKGAFWFRFRJ-UHFFFAOYSA-N.
| Molecular formula | C12H19BO2 |
|---|---|
| Molecular weight | 206.09 g/mol |
| IUPAC name | (4-hexylphenyl)boronic acid |
| InChIKey | CFYBKGAFWFRFRJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CCCCCC)(O)O |
Computed by PubChem (NCBI)