cas: 363166-79-4 — see every product listed under this CAS number, including other names
2,6–Diisopropylphenylboronic acid (CAS 363166-79-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD10645-1g |
| cas | 363166-79-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 1163.38 Pln | |
| GLPBio | 250mg | 690.65 Pln | |
| GLPBio | 5g | 2380.31 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[2,6-di(propan-2-yl)phenyl]boronic acid (CAS 363166-79-4) is a chemical compound with the molecular formula C12H19BO2 and a molecular weight of 206.09 g/mol. IUPAC name: [2,6-di(propan-2-yl)phenyl]boronic acid. InChIKey: UPXGMXMTUMCLGD-UHFFFAOYSA-N.
| Molecular formula | C12H19BO2 |
|---|---|
| Molecular weight | 206.09 g/mol |
| IUPAC name | [2,6-di(propan-2-yl)phenyl]boronic acid |
| InChIKey | UPXGMXMTUMCLGD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1C(C)C)C(C)C)(O)O |
Computed by PubChem (NCBI)