cas: 10311-40-7 — see every product listed under this CAS number, including other names
2,6-Dimethyl-3-(methylsulfonyl)aniline (CAS 10311-40-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023615-250MG |
| cas | 10311-40-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 664.37 Pln | |
| Fluorochem | 5g | 7620.25 Pln |
| delivery time | 2-3 weeks |
|---|
2,6-dimethyl-3-methylsulfonylaniline (CAS 10311-40-7) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 2,6-dimethyl-3-methylsulfonylaniline. InChIKey: IAWUBBZDJUPVOE-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 2,6-dimethyl-3-methylsulfonylaniline |
| InChIKey | IAWUBBZDJUPVOE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)S(=O)(=O)C)C)N |
Computed by PubChem (NCBI)