CAS 10311-40-7 is the registry number for 2,6-Dimethyl-3-(methylsulfonyl)aniline, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
2,6-dimethyl-3-methylsulfonylaniline (CAS 10311-40-7) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 2,6-dimethyl-3-methylsulfonylaniline. InChIKey: IAWUBBZDJUPVOE-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 2,6-dimethyl-3-methylsulfonylaniline |
| InChIKey | IAWUBBZDJUPVOE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)S(=O)(=O)C)C)N |
Computed by PubChem (NCBI)