CAS 86810-78-8 is the registry number for 4-(Propane-1-sulfonyl)aniline, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-propylsulfonylaniline (CAS 86810-78-8) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 4-propylsulfonylaniline. InChIKey: UPYAKDAOBGDGJU-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 4-propylsulfonylaniline |
| InChIKey | UPYAKDAOBGDGJU-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)