Products 1267233-79-3

CAS 1267233-79-3 appears in our catalog under these names: 4-Butyl-2-methyl-1,3-thiazole-5-carboxylic acid, 95%, 4-Butyl-2-methyl-1,3-thiazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

4-butyl-2-methyl-1,3-thiazole-5-carboxylic acid (CAS 1267233-79-3) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 4-butyl-2-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: CPCZNRDNIDBNGA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO2S
Molecular weight199.27 g/mol
IUPAC name4-butyl-2-methyl-1,3-thiazole-5-carboxylic acid
InChIKeyCPCZNRDNIDBNGA-UHFFFAOYSA-N
SMILESCCCCC1=C(SC(=N1)C)C(=O)O

Computed by PubChem (NCBI)