cas: 6994-63-4 — see every product listed under this CAS number, including other names
2,6-Dimethyl-3-nitrophenol 95% (CAS 6994-63-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A421971-100mg |
| cas | 6994-63-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 526.12 Pln | |
| Ambeed | 1g | 1104.63 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A421971 |
2,6-dimethyl-3-nitrophenol (CAS 6994-63-4) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,6-dimethyl-3-nitrophenol. InChIKey: TZASZCQVZPLXHP-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,6-dimethyl-3-nitrophenol |
| InChIKey | TZASZCQVZPLXHP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])C)O |
Computed by PubChem (NCBI)