cas: 6994-63-4 — see every product listed under this CAS number, including other names
2,6-Dimethyl-3-nitrophenol, 95%, 95% (CAS 6994-63-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FVAM-100mg |
| cas | 6994-63-4 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 414.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,6-dimethyl-3-nitrophenol (CAS 6994-63-4) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,6-dimethyl-3-nitrophenol. InChIKey: TZASZCQVZPLXHP-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,6-dimethyl-3-nitrophenol |
| InChIKey | TZASZCQVZPLXHP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])C)O |
Computed by PubChem (NCBI)