cas: 13603-45-7 — see every product listed under this CAS number, including other names
2,6-Dimethyl-3-nitropyridin-4-ol, 96% (CAS 13603-45-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209479-1G |
| cas | 13603-45-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 227.02 Pln | |
| Fluorochem | 10g | 404.04 Pln | |
| Fluorochem | 25g | 690.40 Pln | |
| Fluorochem | 100g | 2580.36 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2,6-dimethyl-3-nitro-1H-pyridin-4-one (CAS 13603-45-7) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 2,6-dimethyl-3-nitro-1H-pyridin-4-one. InChIKey: PKAUZTQOCSCVLK-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2,6-dimethyl-3-nitro-1H-pyridin-4-one |
| InChIKey | PKAUZTQOCSCVLK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=C(N1)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)