CAS 13603-45-7 appears in our catalog under these names: 2,6-Dimethyl-3-nitro-4-pyridinol, 98%, 2,6–Dimethyl–3–nitropyridin–4–ol, 2,6-Dimethyl-3-nitropyridin-4-ol 98%, 2,6-Dimethyl-3-nitropyridin-4-ol, 98%, 98%, 2,6-Dimethyl-3-nitropyridin-4-ol, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g.
2,6-dimethyl-3-nitro-1H-pyridin-4-one (CAS 13603-45-7) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 2,6-dimethyl-3-nitro-1H-pyridin-4-one. InChIKey: PKAUZTQOCSCVLK-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2,6-dimethyl-3-nitro-1H-pyridin-4-one |
| InChIKey | PKAUZTQOCSCVLK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=C(N1)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)