cas: 890839-23-3 — see every product listed under this CAS number, including other names
2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97% (CAS 890839-23-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A764429-1g |
| cas | 890839-23-3 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4679.08 Pln | |
| Fluorochem | 100mg | 768.50 Pln | |
| Fluorochem | 250mg | 1486.99 Pln | |
| Fluorochem | 500mg | 2918.78 Pln | |
| Fluorochem | 1g | 3783.06 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 890839-23-3) is a chemical compound with the molecular formula C15H21BO4 and a molecular weight of 276.14 g/mol. IUPAC name: 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: HBJAFRDEINBTEQ-UHFFFAOYSA-N.
| Molecular formula | C15H21BO4 |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | HBJAFRDEINBTEQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)C)C(=O)O)C |
Computed by PubChem (NCBI)