CAS 2121511-84-8 is the registry number for 3-Formyl-4-methoxy-5-methylphenyl boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2-methoxy-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 2121511-84-8) is a chemical compound with the molecular formula C15H21BO4 and a molecular weight of 276.14 g/mol. IUPAC name: 2-methoxy-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: IXCXCGJDHMRWKD-UHFFFAOYSA-N.
| Molecular formula | C15H21BO4 |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | 2-methoxy-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | IXCXCGJDHMRWKD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)C=O)OC)C |
Computed by PubChem (NCBI)