CAS 1268350-47-5 is the registry number for 3,4-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
3,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 1268350-47-5) is a chemical compound with the molecular formula C15H21BO4 and a molecular weight of 276.14 g/mol. IUPAC name: 3,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: ZNWPYBXTTPJEHU-UHFFFAOYSA-N.
| Molecular formula | C15H21BO4 |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | 3,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | ZNWPYBXTTPJEHU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2C)C)C(=O)O |
Computed by PubChem (NCBI)