CAS 562098-08-2 appears in our catalog under these names: (4-Acetoxymethylphenyl)boronic acid pinacol ester, 95%, (4-Acetoxymethylphenyl)boronicacidpinacolester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate (CAS 562098-08-2) is a chemical compound with the molecular formula C15H21BO4 and a molecular weight of 276.14 g/mol. IUPAC name: [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate. InChIKey: CINSSLPYZWYFSB-UHFFFAOYSA-N.
| Molecular formula | C15H21BO4 |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate |
| InChIKey | CINSSLPYZWYFSB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)COC(=O)C |
Computed by PubChem (NCBI)