cas: 325142-95-8 — see every product listed under this CAS number, including other names
2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 97%, 97% (CAS 325142-95-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 100g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G6H-100mg |
| cas | 325142-95-8 |
| size | 100mg |
| availability | 900g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 506.00 Pln | |
| Chemat | 10g | 942.80 Pln | |
| Chemat | 100g | 8387.60 Pln | |
| Chemat | 25g | 2243.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 325142-95-8) is a chemical compound with the molecular formula C13H20BNO2 and a molecular weight of 233.12 g/mol. IUPAC name: 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: XYNDKPYVNTVDAH-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO2 |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | 2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | XYNDKPYVNTVDAH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)C)C |
Computed by PubChem (NCBI)