cas: 2423-71-4 — see every product listed under this CAS number, including other names
2,6-Dimethyl-4-nitrophenol, >98.0%(GC) (CAS 2423-71-4) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2531-25G |
| cas | 2423-71-4 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 703.50 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2,6-dimethyl-4-nitrophenol (CAS 2423-71-4) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,6-dimethyl-4-nitrophenol. InChIKey: FNORUNUDZNWQFF-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,6-dimethyl-4-nitrophenol |
| InChIKey | FNORUNUDZNWQFF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)