CAS 2423-71-4 appears in our catalog under these names: 2,6–Dimethyl–4–nitrophenol, 2,6-Dimethyl-4-nitrophenol, 2,6-dimethyl-4-nitrophenol, 96%, 2,6-Dimethyl-4-nitrophenol, 98% , 2,6-Dimethyl-4-nitrophenol 98%. Offered by: GLPBio, Biosynth, Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g, 100mg, 500mg.
2,6-dimethyl-4-nitrophenol (CAS 2423-71-4) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,6-dimethyl-4-nitrophenol. InChIKey: FNORUNUDZNWQFF-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,6-dimethyl-4-nitrophenol |
| InChIKey | FNORUNUDZNWQFF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)