cas: 33259-21-1 — see every product listed under this CAS number, including other names
2,6-dimethyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid, 97% (CAS 33259-21-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F693107-100MG |
| cas | 33259-21-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 825.77 Pln | |
| Fluorochem | 5g | 3434.23 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid (CAS 33259-21-1) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid. InChIKey: SXBRRFLLEOHXIO-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | SXBRRFLLEOHXIO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=C(N1)C)C(=O)O |
Computed by PubChem (NCBI)