cas: 33259-21-1 — see every product listed under this CAS number, including other names
4-Hydroxy-2,6-dimethylnicotinic acid, 95%, 95% (CAS 33259-21-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLXY-100mg |
| cas | 33259-21-1 |
| size | 100mg |
| availability | 9.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1878.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid (CAS 33259-21-1) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid. InChIKey: SXBRRFLLEOHXIO-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | SXBRRFLLEOHXIO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=C(N1)C)C(=O)O |
Computed by PubChem (NCBI)