cas: 1357354-49-4 — see every product listed under this CAS number, including other names
2,7-DIAZA-SPIRO[4.4]NONANE-2,9-DICARBOXYLIC ACID 2-TERT-BUTYL ESTER 9-ETHYL ESTER, 97% (CAS 1357354-49-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467475-100MG |
| cas | 1357354-49-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 919.49 Pln | |
| Fluorochem | 250mg | 1497.41 Pln | |
| Fluorochem | 500mg | 2455.40 Pln | |
| Fluorochem | 1g | 3606.04 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-O-tert-butyl 9-O-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate (CAS 1357354-49-4) is a chemical compound with the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. IUPAC name: 2-O-tert-butyl 9-O-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate. InChIKey: LKKYIMUKDUHHII-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O4 |
|---|---|
| Molecular weight | 298.38 g/mol |
| IUPAC name | 2-O-tert-butyl 9-O-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate |
| InChIKey | LKKYIMUKDUHHII-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CNCC12CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)