cas: 1357354-49-4 — see every product listed under this CAS number, including other names
2-tert-Butyl 9-ethyl 2,7-diazaspiro(4.4)nonane-2,9-dicarboxylate, 97% (CAS 1357354-49-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A113602-5g |
| cas | 1357354-49-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14170.66 Pln | |
| AmBeed | 10g | 23141.44 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-O-tert-butyl 9-O-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate (CAS 1357354-49-4) is a chemical compound with the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. IUPAC name: 2-O-tert-butyl 9-O-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate. InChIKey: LKKYIMUKDUHHII-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O4 |
|---|---|
| Molecular weight | 298.38 g/mol |
| IUPAC name | 2-O-tert-butyl 9-O-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate |
| InChIKey | LKKYIMUKDUHHII-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CNCC12CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)