cas: 1279856-08-4 — see every product listed under this CAS number, including other names
2,7-DIAZASPIRO[4.5]DECANE-7-CARBOXYLIC ACID, 1,1-DIMETHYLETHYL ESTER, HCL, 97% (CAS 1279856-08-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F332647-100MG |
| cas | 1279856-08-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 341.56 Pln | |
| Fluorochem | 250mg | 685.19 Pln | |
| Fluorochem | 1g | 1580.71 Pln | |
| Fluorochem | 5g | 4605.69 Pln | |
| Fluorochem | 10g | 7229.76 Pln | |
| Fluorochem | 25g | 14242.92 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate;hydrochloride (CAS 1279856-08-4) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate;hydrochloride. InChIKey: DSLZXSCWMHHHKN-UHFFFAOYSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate;hydrochloride |
| InChIKey | DSLZXSCWMHHHKN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CCNC2.Cl |
Computed by PubChem (NCBI)