CAS 1820569-14-9 appears in our catalog under these names: tert-Butyl rac-(1s,5r)-3,9-diazabicyclo[3.3.2]decane-9-carboxylate hydrochloride, 95%, (1S,5R)-tert-Butyl 3,9-diazabicyclo(3.3.2)decane-9-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
Tert-butyl (1S,5R)-3,9-diazabicyclo[3.3.2]decane-9-carboxylate;hydrochloride (CAS 1820569-14-9) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl (1S,5R)-3,9-diazabicyclo[3.3.2]decane-9-carboxylate;hydrochloride. InChIKey: KCGHVBXKZWOICS-DHXVBOOMSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl (1S,5R)-3,9-diazabicyclo[3.3.2]decane-9-carboxylate;hydrochloride |
| InChIKey | KCGHVBXKZWOICS-DHXVBOOMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CCC[C@H]1CNC2.Cl |
Computed by PubChem (NCBI)