CAS 1279856-08-4 appears in our catalog under these names: tert-Butyl 2,7-diazaspiro[4.5]decane-7-carboxylate hydrochloride, 98%, tert-Butyl 2,7-diazaspiro(4.5)decane-7-carboxylate hydrochloride, 97%, 2,7–DIAZASPIRO(4·5)DECANE–7–CARBOXYLIC ACID, 1,1–DIMETHYLETHYL ESTER, HCL, tert-Butyl 2,7-diazaspiro[4.5]decane-7-carboxylate hydrochloride, 97%, 97%, 2,7-DIAZASPIRO[4.5]DECANE-7-CARBOXYLIC ACID, 1,1-DIMETHYLETHYL ESTER, HCL, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g.
Tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate;hydrochloride (CAS 1279856-08-4) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate;hydrochloride. InChIKey: DSLZXSCWMHHHKN-UHFFFAOYSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate;hydrochloride |
| InChIKey | DSLZXSCWMHHHKN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CCNC2.Cl |
Computed by PubChem (NCBI)