Products 1153767-91-9

CAS 1153767-91-9 appears in our catalog under these names: 1,8-Diazaspiro[4.5]decane-1-carboxylic acid tert-butyl ester hydrochloride, 95%, tert-Butyl 1,8-diazaspiro(4.5)decane-1-carboxylate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 10g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 1,8-diazaspiro[4.5]decane-1-carboxylate;hydrochloride (CAS 1153767-91-9) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 1,8-diazaspiro[4.5]decane-1-carboxylate;hydrochloride. InChIKey: RDKNFQFBKPYPKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H25ClN2O2
Molecular weight276.80 g/mol
IUPAC nametert-butyl 1,8-diazaspiro[4.5]decane-1-carboxylate;hydrochloride
InChIKeyRDKNFQFBKPYPKJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC12CCNCC2.Cl

Computed by PubChem (NCBI)