cas: 961-27-3 — see every product listed under this CAS number, including other names
2,7-Diacetylfluorene, 98%, 98% (CAS 961-27-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G7K-250mg |
| cas | 961-27-3 |
| size | 250mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 434.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(7-acetyl-9H-fluoren-2-yl)ethanone (CAS 961-27-3) is a chemical compound with the molecular formula C17H14O2 and a molecular weight of 250.29 g/mol. IUPAC name: 1-(7-acetyl-9H-fluoren-2-yl)ethanone. InChIKey: RIRYGERFWHUZBT-UHFFFAOYSA-N.
| Molecular formula | C17H14O2 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 1-(7-acetyl-9H-fluoren-2-yl)ethanone |
| InChIKey | RIRYGERFWHUZBT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C3=C(C2)C=C(C=C3)C(=O)C |
Computed by PubChem (NCBI)