CAS 54763-67-6 is the registry number for 3'-(p-Tolyl)spiro[indene-2,2'-oxiran]-1(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3'-(4-methylphenyl)spiro[3H-indene-2,2'-oxirane]-1-one (CAS 54763-67-6) is a chemical compound with the molecular formula C17H14O2 and a molecular weight of 250.29 g/mol. IUPAC name: 3'-(4-methylphenyl)spiro[3H-indene-2,2'-oxirane]-1-one. InChIKey: ZULDHUGNBSXZRW-UHFFFAOYSA-N.
| Molecular formula | C17H14O2 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 3'-(4-methylphenyl)spiro[3H-indene-2,2'-oxirane]-1-one |
| InChIKey | ZULDHUGNBSXZRW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2C3(O2)CC4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)