Products 46969-53-3

CAS 46969-53-3 is the registry number for 9-Fluorenyl methacrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

9H-fluoren-9-yl 2-methylprop-2-enoate (CAS 46969-53-3) is a chemical compound with the molecular formula C17H14O2 and a molecular weight of 250.29 g/mol. IUPAC name: 9H-fluoren-9-yl 2-methylprop-2-enoate. InChIKey: IFAFXDPXPSZLKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14O2
Molecular weight250.29 g/mol
IUPAC name9H-fluoren-9-yl 2-methylprop-2-enoate
InChIKeyIFAFXDPXPSZLKZ-UHFFFAOYSA-N
SMILESCC(=C)C(=O)OC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)