CAS 46969-53-3 is the registry number for 9-Fluorenyl methacrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
9H-fluoren-9-yl 2-methylprop-2-enoate (CAS 46969-53-3) is a chemical compound with the molecular formula C17H14O2 and a molecular weight of 250.29 g/mol. IUPAC name: 9H-fluoren-9-yl 2-methylprop-2-enoate. InChIKey: IFAFXDPXPSZLKZ-UHFFFAOYSA-N.
| Molecular formula | C17H14O2 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 9H-fluoren-9-yl 2-methylprop-2-enoate |
| InChIKey | IFAFXDPXPSZLKZ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)