CAS 6549-64-0 is the registry number for 2-(3,5-Dimethylphenyl)-1H-indene-1,3(2H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-dimethylphenyl)indene-1,3-dione (CAS 6549-64-0) is a chemical compound with the molecular formula C17H14O2 and a molecular weight of 250.29 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)indene-1,3-dione. InChIKey: GENPWUDLQYMNRM-UHFFFAOYSA-N.
| Molecular formula | C17H14O2 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)indene-1,3-dione |
| InChIKey | GENPWUDLQYMNRM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2C(=O)C3=CC=CC=C3C2=O)C |
Computed by PubChem (NCBI)