cas: 73150-67-1 — see every product listed under this CAS number, including other names
2–(2–Aminothiazol–4–yl)–2–oxoacetic acid (CAS 73150-67-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF42126-10g |
| cas | 73150-67-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 2867.08 Pln | |
| GLPBio | 1g | 807.66 Pln | |
| GLPBio | 250mg | 587.68 Pln | |
| GLPBio | 5g | 1884.18 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetic acid (CAS 73150-67-1) is a chemical compound with the molecular formula C5H4N2O3S and a molecular weight of 172.16 g/mol. IUPAC name: 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetic acid. InChIKey: VMASTYPGLHRVNL-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3S |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetic acid |
| InChIKey | VMASTYPGLHRVNL-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)N)C(=O)C(=O)O |
Computed by PubChem (NCBI)