cas: 73150-67-1 — see every product listed under this CAS number, including other names
2-(2-Aminothiazol-4-Yl)-2-Oxoacetic Acid, 98%, 98% (CAS 73150-67-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1174Q5-100mg |
| cas | 73150-67-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 966.80 Pln | |
| Chemat | 10g | 1600.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetic acid (CAS 73150-67-1) is a chemical compound with the molecular formula C5H4N2O3S and a molecular weight of 172.16 g/mol. IUPAC name: 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetic acid. InChIKey: VMASTYPGLHRVNL-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3S |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetic acid |
| InChIKey | VMASTYPGLHRVNL-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)N)C(=O)C(=O)O |
Computed by PubChem (NCBI)