cas: 20846-38-2 — see every product listed under this CAS number, including other names
2–Amino–3–(3–iodophenyl)propanoic acid (CAS 20846-38-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB54364-100 |
| cas | 20846-38-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 517.47 Pln | |
| GLPBio | 1g | 934.04 Pln | |
| GLPBio | 250mg | 597.04 Pln | |
| GLPBio | 5g | 2230.53 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-3-(3-iodophenyl)propanoic acid (CAS 20846-38-2) is a chemical compound with the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. IUPAC name: 2-amino-3-(3-iodophenyl)propanoic acid. InChIKey: BABTYIKKTLTNRX-UHFFFAOYSA-N.
| Molecular formula | C9H10INO2 |
|---|---|
| Molecular weight | 291.09 g/mol |
| IUPAC name | 2-amino-3-(3-iodophenyl)propanoic acid |
| InChIKey | BABTYIKKTLTNRX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)I)CC(C(=O)O)N |
Computed by PubChem (NCBI)