Products 2091215-50-6

CAS 2091215-50-6 is the registry number for 3-Amino-2-iodo-6-methyl-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-amino-2-iodo-6-methylbenzoate (CAS 2091215-50-6) is a chemical compound with the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. IUPAC name: methyl 3-amino-2-iodo-6-methylbenzoate. InChIKey: YWLNYAVWUJYETO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10INO2
Molecular weight291.09 g/mol
IUPAC namemethyl 3-amino-2-iodo-6-methylbenzoate
InChIKeyYWLNYAVWUJYETO-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)N)I)C(=O)OC

Computed by PubChem (NCBI)