CAS 20846-38-2 appears in our catalog under these names: 2–Amino–3–(3–iodophenyl)propanoic acid, 2-Amino-3-(3-iodophenyl)propanoic acid, 95%, 2-Amino-3-(3-iodophenyl)propanoic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-amino-3-(3-iodophenyl)propanoic acid (CAS 20846-38-2) is a chemical compound with the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. IUPAC name: 2-amino-3-(3-iodophenyl)propanoic acid. InChIKey: BABTYIKKTLTNRX-UHFFFAOYSA-N.
| Molecular formula | C9H10INO2 |
|---|---|
| Molecular weight | 291.09 g/mol |
| IUPAC name | 2-amino-3-(3-iodophenyl)propanoic acid |
| InChIKey | BABTYIKKTLTNRX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)I)CC(C(=O)O)N |
Computed by PubChem (NCBI)