CAS 736184-44-4 appears in our catalog under these names: 2-Iodo-d-phenylalanine, 95%, (R)-2-Amino-3-(2-iodophenyl)propanoic acid, 97+%, 2-Iodo-D-phenylalanine, 95%, 95%, (R)-2-Amino-3-(2-iodophenyl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg.
(2R)-2-amino-3-(2-iodophenyl)propanoic acid (CAS 736184-44-4) is a chemical compound with the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. IUPAC name: (2R)-2-amino-3-(2-iodophenyl)propanoic acid. InChIKey: BKXVGLPBXYBDDM-MRVPVSSYSA-N.
| Molecular formula | C9H10INO2 |
|---|---|
| Molecular weight | 291.09 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-iodophenyl)propanoic acid |
| InChIKey | BKXVGLPBXYBDDM-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](C(=O)O)N)I |
Computed by PubChem (NCBI)