cas: 1214348-47-6 — see every product listed under this CAS number, including other names
2–Chloro–3–methoxy–6–(trifluoromethyl)pyridine (CAS 1214348-47-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF36594-100mg |
| cas | 1214348-47-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 615.76 Pln | |
| GLPBio | 1g | 1491.02 Pln | |
| GLPBio | 250mg | 770.22 Pln | |
| GLPBio | 5g | 5520.93 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-3-methoxy-6-(trifluoromethyl)pyridine (CAS 1214348-47-6) is a chemical compound with the molecular formula C7H5ClF3NO and a molecular weight of 211.57 g/mol. IUPAC name: 2-chloro-3-methoxy-6-(trifluoromethyl)pyridine. InChIKey: CBYYYYRJKKWLDI-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO |
|---|---|
| Molecular weight | 211.57 g/mol |
| IUPAC name | 2-chloro-3-methoxy-6-(trifluoromethyl)pyridine |
| InChIKey | CBYYYYRJKKWLDI-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)