Products 1258641-42-7
CAS 1258641-42-7 appears in our catalog under these names: 5-Chloro-2-(2,2,2-trifluoroethoxy)pyridine, 95%, 5-Chloro-2-(2,2,2-trifluoroethoxy)pyridine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
5-chloro-2-(2,2,2-trifluoroethoxy)pyridine (CAS 1258641-42-7) is a chemical compound with the molecular formula C7H5ClF3NO and a molecular weight of 211.57 g/mol. IUPAC name: 5-chloro-2-(2,2,2-trifluoroethoxy)pyridine. InChIKey: BMEAABIZRAHLIW-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO |
|---|---|
| Molecular weight | 211.57 g/mol |
| IUPAC name | 5-chloro-2-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | BMEAABIZRAHLIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)OCC(F)(F)F |
Computed by PubChem (NCBI)