Products 1281189-85-2
CAS 1281189-85-2 appears in our catalog under these names: 3-Chloro-1-methyl-5-(trifluoromethyl)pyridin-2-one, 95%, 3-Chloro-1-methyl-5-(trifluoromethyl)-1,2-dihydropyridin-2-one. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 5g, 500mg.
3-chloro-1-methyl-5-(trifluoromethyl)pyridin-2-one (CAS 1281189-85-2) is a chemical compound with the molecular formula C7H5ClF3NO and a molecular weight of 211.57 g/mol. IUPAC name: 3-chloro-1-methyl-5-(trifluoromethyl)pyridin-2-one. InChIKey: YVNPFRDUUGSWRV-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO |
|---|---|
| Molecular weight | 211.57 g/mol |
| IUPAC name | 3-chloro-1-methyl-5-(trifluoromethyl)pyridin-2-one |
| InChIKey | YVNPFRDUUGSWRV-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C(C1=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)